C26H33F6N3O4 — CID 161467741
carbon dioxide;1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(4-methyl-3-piperidin-1-ylphenyl)methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 161467741) has the molecular formula C26H33F6N3O4 and a molecular weight of 565.56 g/mol. Its IUPAC name is carbon dioxide;1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(4-methyl-3-piperidin-1-ylphenyl)methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | carbon dioxide;1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(4-methyl-3-piperidin-1-ylphenyl)methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 161467741 |
| Molecular Formula | C26H33F6N3O4 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | carbon dioxide;1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(4-methyl-3-piperidin-1-ylphenyl)methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | Cc1ccc(CN2CCC3(CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)C2)cc1N1CCCCC1.O=C=O |
| InChI | InChI=1S/C25H33F6N3O2.CO2/c1-18-5-6-19(15-20(18)33-10-3-2-4-11-33)16-32-12-7-23(17-32)8-13-34(14-9-23)22(35)36-21(24(26,27)28)25(29,30)31;2-1-3/h5-6,15,21H,2-4,7-14,16-17H2,1H3; |
| InChIKey | WCQYYRRUEVBXTJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |