C23H27ClF6N2O5 — CID 164755065
4-[3-chloro-5-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]phenoxy]butanoic acid (PubChem CID 164755065) has the molecular formula C23H27ClF6N2O5 and a molecular weight of 560.92 g/mol. Its IUPAC name is 4-[3-chloro-5-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[3-chloro-5-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 164755065 |
| Molecular Formula | C23H27ClF6N2O5 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 4-[3-chloro-5-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cc(Cl)cc(CN2CCC3(CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)C2)c1 |
| InChI | InChI=1S/C23H27ClF6N2O5/c24-16-10-15(11-17(12-16)36-9-1-2-18(33)34)13-31-6-3-21(14-31)4-7-32(8-5-21)20(35)37-19(22(25,26)27)23(28,29)30/h10-12,19H,1-9,13-14H2,(H,33,34) |
| InChIKey | RVWPPIUXNLWNFT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|