C24H28F9N3O4 — CID 167052051
4-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-2-yl]methyl]-5-(trifluoromethyl)anilino]butanoic acid (PubChem CID 167052051) has the molecular formula C24H28F9N3O4 and a molecular weight of 593.49 g/mol. Its IUPAC name is 4-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-2-yl]methyl]-5-(trifluoromethyl)anilino]butanoic acid.
| Compound Name | 4-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-2-yl]methyl]-5-(trifluoromethyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 167052051 |
| Molecular Formula | C24H28F9N3O4 |
| Molecular Weight | 593.49 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 4-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-2-yl]methyl]-5-(trifluoromethyl)anilino]butanoic acid |
| SMILES | O=C(O)CCCNc1cc(CC2CCC3(CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)N2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H28F9N3O4/c25-22(26,27)15-10-14(12-17(13-15)34-7-1-2-18(37)38)11-16-3-4-21(35-16)5-8-36(9-6-21)20(39)40-19(23(28,29)30)24(31,32)33/h10,12-13,16,19,34-35H,1-9,11H2,(H,37,38) |
| InChIKey | OQKLYTNJNGZLON-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|