C13H15BrF3NO2 — CID 65489628
6-[3-bromo-5-(trifluoromethyl)anilino]hexanoic acid (PubChem CID 65489628) has the molecular formula C13H15BrF3NO2 and a molecular weight of 354.17 g/mol. Its IUPAC name is 6-[3-bromo-5-(trifluoromethyl)anilino]hexanoic acid.
| Compound Name | 6-[3-bromo-5-(trifluoromethyl)anilino]hexanoic acid |
|---|---|
| PubChem CID | 65489628 |
| Molecular Formula | C13H15BrF3NO2 |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 6-[3-bromo-5-(trifluoromethyl)anilino]hexanoic acid |
| SMILES | O=C(O)CCCCCNc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15BrF3NO2/c14-10-6-9(13(15,16)17)7-11(8-10)18-5-3-1-2-4-12(19)20/h6-8,18H,1-5H2,(H,19,20) |
| InChIKey | NJJFLDVZRMRVGT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|