C21H32N4O2 — CID 129055383
2-[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazin-1-yl]-N-[(E)-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enylidene]amino]acetamide (PubChem CID 129055383) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazin-1-yl]-N-[(E)-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enylidene]amino]acetamide.
| Compound Name | 2-[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazin-1-yl]-N-[(E)-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 129055383 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2-[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazin-1-yl]-N-[(E)-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enylidene]amino]acetamide |
| SMILES | C=C/C=C\C(=C/C)CN1CCN(CC(=O)N/N=C/C(=C/C)/C(O)=C\C)CC1 |
| InChI | InChI=1S/C21H32N4O2/c1-5-9-10-18(6-2)16-24-11-13-25(14-12-24)17-21(27)23-22-15-19(7-3)20(26)8-4/h5-10,15,26H,1,11-14,16-17H2,2-4H3,(H,23,27)/b10-9-,18-6+,19-7-,20-8+,22-15+ |
| InChIKey | YDNIBGAVDNSWLM-DMNMXESASA-N |
| XLogP | 2.80 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|