C19H26F6N2O2 — CID 166814002
1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[methyl-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]amino]piperidine-1-carboxylate (PubChem CID 166814002) has the molecular formula C19H26F6N2O2 and a molecular weight of 428.42 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[methyl-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]amino]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[methyl-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166814002 |
| Molecular Formula | C19H26F6N2O2 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-4-[methyl-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]amino]piperidine-1-carboxylate |
| SMILES | C=C/C=C\C=C(/C)CN(C)C1(C)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H26F6N2O2/c1-5-6-7-8-14(2)13-26(4)17(3)9-11-27(12-10-17)16(28)29-15(18(20,21)22)19(23,24)25/h5-8,15H,1,9-13H2,2-4H3/b7-6-,14-8+ |
| InChIKey | KJHRUDIQRNPEDZ-BHWOWGIZSA-N |
| XLogP | 5.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|