C22H26F6N2O4 — CID 134365325
1-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-6-methylphenyl]cyclopentane-1-carboxylic acid (PubChem CID 134365325) has the molecular formula C22H26F6N2O4 and a molecular weight of 496.45 g/mol. Its IUPAC name is 1-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-6-methylphenyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-6-methylphenyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 134365325 |
| Molecular Formula | C22H26F6N2O4 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 1-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-6-methylphenyl]cyclopentane-1-carboxylic acid |
| SMILES | Cc1cccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c1C1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C22H26F6N2O4/c1-14-5-4-6-15(16(14)20(18(31)32)7-2-3-8-20)13-29-9-11-30(12-10-29)19(33)34-17(21(23,24)25)22(26,27)28/h4-6,17H,2-3,7-13H2,1H3,(H,31,32) |
| InChIKey | UNYSXKHNNHRTNQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |