C38H50F8N4O8 — CID 159819109
tert-butyl 2-[2-fluoro-6-(piperazin-1-ylmethyl)phenoxy]acetate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 159819109) has the molecular formula C38H50F8N4O8 and a molecular weight of 842.82 g/mol. Its IUPAC name is tert-butyl 2-[2-fluoro-6-(piperazin-1-ylmethyl)phenoxy]acetate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-fluoro-6-(piperazin-1-ylmethyl)phenoxy]acetate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 159819109 |
| Molecular Formula | C38H50F8N4O8 |
| Molecular Weight | 842.82 g/mol |
| Exact Mass | 842.35 |
| IUPAC Name | tert-butyl 2-[2-fluoro-6-(piperazin-1-ylmethyl)phenoxy]acetate;1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)COc1c(F)cccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1.CC(C)(C)OC(=O)COc1c(F)cccc1CN1CCNCC1 |
| InChI | InChI=1S/C21H25F7N2O5.C17H25FN2O3/c1-19(2,3)35-15(31)12-33-16-13(5-4-6-14(16)22)11-29-7-9-30(10-8-29)18(32)34-17(20(23,24)25)21(26,27)28;1-17(2,3)23-15(21)12-22-16-13(5-4-6-14(16)18)11-20-9-7-19-8-10-20/h4-6,17H,7-12H2,1-3H3;4-6,19H,7-12H2,1-3H3 |
| InChIKey | NLZQMSZMKZEZNI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.82 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|