C25H31ClF6N2O4 — CID 138746910
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(1-butoxycarbonylcyclopentyl)-4-chlorophenyl]methyl]piperazine-1-carboxylate (PubChem CID 138746910) has the molecular formula C25H31ClF6N2O4 and a molecular weight of 572.97 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(1-butoxycarbonylcyclopentyl)-4-chlorophenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(1-butoxycarbonylcyclopentyl)-4-chlorophenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 138746910 |
| Molecular Formula | C25H31ClF6N2O4 |
| Molecular Weight | 572.97 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(1-butoxycarbonylcyclopentyl)-4-chlorophenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)C1(c2cc(Cl)ccc2CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)CCCC1 |
| InChI | InChI=1S/C25H31ClF6N2O4/c1-2-3-14-37-21(35)23(8-4-5-9-23)19-15-18(26)7-6-17(19)16-33-10-12-34(13-11-33)22(36)38-20(24(27,28)29)25(30,31)32/h6-7,15,20H,2-5,8-14,16H2,1H3 |
| InChIKey | ZITCKTHEPVXXMC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.97 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|