C19H22ClF6N3O5 — CID 134496325
2-[2-[4-chloro-2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]anilino]ethoxy]acetic acid (PubChem CID 134496325) has the molecular formula C19H22ClF6N3O5 and a molecular weight of 521.84 g/mol. Its IUPAC name is 2-[2-[4-chloro-2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]anilino]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-chloro-2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]anilino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 134496325 |
| Molecular Formula | C19H22ClF6N3O5 |
| Molecular Weight | 521.84 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 2-[2-[4-chloro-2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]anilino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNc1ccc(Cl)cc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H22ClF6N3O5/c20-13-1-2-14(27-3-8-33-11-15(30)31)12(9-13)10-28-4-6-29(7-5-28)17(32)34-16(18(21,22)23)19(24,25)26/h1-2,9,16,27H,3-8,10-11H2,(H,30,31) |
| InChIKey | DGPMLALAYPQVTG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|