C21H27ClF6N4O3 — CID 159829280
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(2-acetamidobutylamino)-4-chlorophenyl]methyl]piperazine-1-carboxylate (PubChem CID 159829280) has the molecular formula C21H27ClF6N4O3 and a molecular weight of 532.91 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(2-acetamidobutylamino)-4-chlorophenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(2-acetamidobutylamino)-4-chlorophenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 159829280 |
| Molecular Formula | C21H27ClF6N4O3 |
| Molecular Weight | 532.91 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(2-acetamidobutylamino)-4-chlorophenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCC(CNc1cc(Cl)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1)NC(C)=O |
| InChI | InChI=1S/C21H27ClF6N4O3/c1-3-16(30-13(2)33)11-29-17-10-15(22)5-4-14(17)12-31-6-8-32(9-7-31)19(34)35-18(20(23,24)25)21(26,27)28/h4-5,10,16,18,29H,3,6-9,11-12H2,1-2H3,(H,30,33) |
| InChIKey | NNGGFOCFDSAYLB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |