About ethane;[(E)-4-methylhex-2-en-3-yl]benzene
ethane;[(E)-4-methylhex-2-en-3-yl]benzene (PubChem CID 167452677) has the molecular formula C17H30
and a molecular weight of 234.43 g/mol. Its IUPAC name is ethane;[(E)-4-methylhex-2-en-3-yl]benzene.
Molecular Properties
| Compound Name | ethane;[(E)-4-methylhex-2-en-3-yl]benzene |
| PubChem CID | 167452677 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | ethane;[(E)-4-methylhex-2-en-3-yl]benzene |
| SMILES | C/C=C(/c1ccccc1)C(C)CC.CC.CC |
| InChI | InChI=1S/C13H18.2C2H6/c1-4-11(3)13(5-2)12-9-7-6-8-10-12;2*1-2/h5-11H,4H2,1-3H3;2*1-2H3/b13-5+;; |
| InChIKey | SNBBREMVMVWOAY-IXYGCXJQSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;[(E)-4-methylhex-2-en-3-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(E)-4-methylhex-2-en-3-yl]benzene?
The IUPAC name of ethane;[(E)-4-methylhex-2-en-3-yl]benzene (CID 167452677) is ethane;[(E)-4-methylhex-2-en-3-yl]benzene.
What is the SMILES notation for ethane;[(E)-4-methylhex-2-en-3-yl]benzene?
The canonical SMILES for ethane;[(E)-4-methylhex-2-en-3-yl]benzene is C/C=C(/c1ccccc1)C(C)CC.CC.CC.
What is the InChIKey of ethane;[(E)-4-methylhex-2-en-3-yl]benzene?
The InChIKey is SNBBREMVMVWOAY-IXYGCXJQSA-N. The full InChI is InChI=1S/C13H18.2C2H6/c1-4-11(3)13(5-2)12-9-7-6-8-10-12;2*1-2/h5-11H,4H2,1-3H3;2*1-2H3/b13-5+;;.
What are the key properties of ethane;[(E)-4-methylhex-2-en-3-yl]benzene?
ethane;[(E)-4-methylhex-2-en-3-yl]benzene has a molecular weight of 234.43 g/mol, XLogP of 6.19, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(E)-4-methylhex-2-en-3-yl]benzene is sourced from PubChem (CID 167452677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).