C26H26O3 — CID 135338672
(E)-3-[4-[(Z)-(4-hydroxyphenyl)-[(1R,2S,6S,7R)-8-tricyclo[5.2.1.02,6]decanylidene]methyl]phenyl]prop-2-enoic acid (PubChem CID 135338672) has the molecular formula C26H26O3 and a molecular weight of 386.49 g/mol. Its IUPAC name is (E)-3-[4-[(Z)-(4-hydroxyphenyl)-[(1R,2S,6S,7R)-8-tricyclo[5.2.1.02,6]decanylidene]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(Z)-(4-hydroxyphenyl)-[(1R,2S,6S,7R)-8-tricyclo[5.2.1.02,6]decanylidene]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135338672 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (E)-3-[4-[(Z)-(4-hydroxyphenyl)-[(1R,2S,6S,7R)-8-tricyclo[5.2.1.02,6]decanylidene]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(/C(=C2\C[C@H]3C[C@@H]2[C@H]2CCC[C@@H]32)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H26O3/c27-20-11-9-18(10-12-20)26(17-7-4-16(5-8-17)6-13-25(28)29)24-15-19-14-23(24)22-3-1-2-21(19)22/h4-13,19,21-23,27H,1-3,14-15H2,(H,28,29)/b13-6+,26-24-/t19-,21+,22+,23-/m1/s1 |
| InChIKey | KOWXHVMLIVHEKU-QGTHWDHRSA-N |
| XLogP | 5.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|