C26H31NO2 — CID 68654568
3-[4-[(4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enamide (PubChem CID 68654568) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-[4-[(4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enamide.
| Compound Name | 3-[4-[(4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68654568 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 3-[4-[(4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enamide |
| SMILES | CC1(C)CC(=C(c2ccc(O)cc2)c2ccc(C=CC(N)=O)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C26H31NO2/c1-25(2)15-21(16-26(3,4)17-25)24(20-10-12-22(28)13-11-20)19-8-5-18(6-9-19)7-14-23(27)29/h5-14,28H,15-17H2,1-4H3,(H2,27,29) |
| InChIKey | NNFCEKYJMMYGOD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|