C32H34O3 — CID 68654469
3-[3-[4-[(4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]phenyl]prop-2-enoic acid (PubChem CID 68654469) has the molecular formula C32H34O3 and a molecular weight of 466.62 g/mol. Its IUPAC name is 3-[3-[4-[(4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[4-[(4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68654469 |
| Molecular Formula | C32H34O3 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 3-[3-[4-[(4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]phenyl]prop-2-enoic acid |
| SMILES | CC1(C)CC(=C(c2ccc(O)cc2)c2ccc(-c3cccc(C=CC(=O)O)c3)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C32H34O3/c1-31(2)19-27(20-32(3,4)21-31)30(25-13-15-28(33)16-14-25)24-11-9-23(10-12-24)26-7-5-6-22(18-26)8-17-29(34)35/h5-18,33H,19-21H2,1-4H3,(H,34,35) |
| InChIKey | NDEYJKKJWBKIIR-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|