C30H25NO6 — CID 159561023
(E)-N-hydroxy-3-[3-(4-hydroxyphenyl)phenyl]prop-2-enamide;(E)-3-[3-(4-hydroxyphenyl)phenyl]prop-2-enoic acid (PubChem CID 159561023) has the molecular formula C30H25NO6 and a molecular weight of 495.53 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[3-(4-hydroxyphenyl)phenyl]prop-2-enamide;(E)-3-[3-(4-hydroxyphenyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-N-hydroxy-3-[3-(4-hydroxyphenyl)phenyl]prop-2-enamide;(E)-3-[3-(4-hydroxyphenyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 159561023 |
| Molecular Formula | C30H25NO6 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (E)-N-hydroxy-3-[3-(4-hydroxyphenyl)phenyl]prop-2-enamide;(E)-3-[3-(4-hydroxyphenyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(/C=C/c1cccc(-c2ccc(O)cc2)c1)NO.O=C(O)/C=C/c1cccc(-c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C15H13NO3.C15H12O3/c17-14-7-5-12(6-8-14)13-3-1-2-11(10-13)4-9-15(18)16-19;16-14-7-5-12(6-8-14)13-3-1-2-11(10-13)4-9-15(17)18/h1-10,17,19H,(H,16,18);1-10,16H,(H,17,18)/b2*9-4+ |
| InChIKey | MGPUVBDVZBRGJK-KPSBCRFLSA-N |
| XLogP | 5.73 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|