C24H18O4S — CID 23537933
(E)-3-[3-[7-hydroxy-3-(4-hydroxyphenyl)-2H-thiochromen-4-yl]phenyl]prop-2-enoic acid (PubChem CID 23537933) has the molecular formula C24H18O4S and a molecular weight of 402.47 g/mol. Its IUPAC name is (E)-3-[3-[7-hydroxy-3-(4-hydroxyphenyl)-2H-thiochromen-4-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[7-hydroxy-3-(4-hydroxyphenyl)-2H-thiochromen-4-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 23537933 |
| Molecular Formula | C24H18O4S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (E)-3-[3-[7-hydroxy-3-(4-hydroxyphenyl)-2H-thiochromen-4-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(C2=C(c3ccc(O)cc3)CSc3cc(O)ccc32)c1 |
| InChI | InChI=1S/C24H18O4S/c25-18-7-5-16(6-8-18)21-14-29-22-13-19(26)9-10-20(22)24(21)17-3-1-2-15(12-17)4-11-23(27)28/h1-13,25-26H,14H2,(H,27,28)/b11-4+ |
| InChIKey | JDNZDBZDWRIRBP-NYYWCZLTSA-N |
| XLogP | 5.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|