C24H20O4S — CID 59109905
(E)-3-[3-[(3S,4R)-7-hydroxy-3-(4-hydroxyphenyl)-3,4-dihydro-2H-thiochromen-4-yl]phenyl]prop-2-enoic acid (PubChem CID 59109905) has the molecular formula C24H20O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is (E)-3-[3-[(3S,4R)-7-hydroxy-3-(4-hydroxyphenyl)-3,4-dihydro-2H-thiochromen-4-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(3S,4R)-7-hydroxy-3-(4-hydroxyphenyl)-3,4-dihydro-2H-thiochromen-4-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59109905 |
| Molecular Formula | C24H20O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (E)-3-[3-[(3S,4R)-7-hydroxy-3-(4-hydroxyphenyl)-3,4-dihydro-2H-thiochromen-4-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc([C@@H]2c3ccc(O)cc3SC[C@@H]2c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C24H20O4S/c25-18-7-5-16(6-8-18)21-14-29-22-13-19(26)9-10-20(22)24(21)17-3-1-2-15(12-17)4-11-23(27)28/h1-13,21,24-26H,14H2,(H,27,28)/b11-4+/t21-,24-/m1/s1 |
| InChIKey | KDWLHYTXEHSDIA-AFXSGLCSSA-N |
| XLogP | 5.22 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|