C23H16O6 — CID 7861643
(3-oxobenzo[f]chromen-1-yl)methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 7861643) has the molecular formula C23H16O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 7861643 |
| Molecular Formula | C23H16O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | O=C(OCc1cc(=O)oc2ccc3ccccc3c12)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C23H16O6/c24-21-11-15(22-16-6-2-1-5-14(16)9-10-19(22)29-21)12-27-23(25)20-13-26-17-7-3-4-8-18(17)28-20/h1-11,20H,12-13H2/t20-/m0/s1 |
| InChIKey | UPYOKXQLAORIMN-FQEVSTJZSA-N |
| XLogP | 3.83 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|