C20H20NO2+ — CID 54607264
1-[(Z)-2-(2,5-dimethoxyphenyl)ethenyl]-2-methylisoquinolin-2-ium (PubChem CID 54607264) has the molecular formula C20H20NO2+ and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-[(Z)-2-(2,5-dimethoxyphenyl)ethenyl]-2-methylisoquinolin-2-ium.
| Compound Name | 1-[(Z)-2-(2,5-dimethoxyphenyl)ethenyl]-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 54607264 |
| Molecular Formula | C20H20NO2+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-[(Z)-2-(2,5-dimethoxyphenyl)ethenyl]-2-methylisoquinolin-2-ium |
| SMILES | COc1ccc(OC)c(/C=C\c2c3ccccc3cc[n+]2C)c1 |
| InChI | InChI=1S/C20H20NO2/c1-21-13-12-15-6-4-5-7-18(15)19(21)10-8-16-14-17(22-2)9-11-20(16)23-3/h4-14H,1-3H3/q+1/b10-8- |
| InChIKey | VWWJBQCBLAUJKG-NTMALXAHSA-N |
| XLogP | 3.85 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|