C30H38N2O2+2 — CID 139200395
4-[(E)-2-[2,5-dibutoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]ethenyl]-1-methylpyridin-1-ium (PubChem CID 139200395) has the molecular formula C30H38N2O2+2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 4-[(E)-2-[2,5-dibutoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]ethenyl]-1-methylpyridin-1-ium.
| Compound Name | 4-[(E)-2-[2,5-dibutoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]ethenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 139200395 |
| Molecular Formula | C30H38N2O2+2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 4-[(E)-2-[2,5-dibutoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]ethenyl]-1-methylpyridin-1-ium |
| SMILES | CCCCOc1cc(/C=C/c2cc[n+](C)cc2)c(OCCCC)cc1/C=C/c1cc[n+](C)cc1 |
| InChI | InChI=1S/C30H38N2O2/c1-5-7-21-33-29-23-28(12-10-26-15-19-32(4)20-16-26)30(34-22-8-6-2)24-27(29)11-9-25-13-17-31(3)18-14-25/h9-20,23-24H,5-8,21-22H2,1-4H3/q+2/b11-9+,12-10+ |
| InChIKey | FRODUCHUADSBJM-WGDLNXRISA-N |
| XLogP | 6.03 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|