C24H18O6 — CID 54231084
5-[2-[2-[2-(3-carboxy-4-hydroxyphenyl)ethenyl]phenyl]ethenyl]-2-hydroxybenzoic acid (PubChem CID 54231084) has the molecular formula C24H18O6 and a molecular weight of 402.40 g/mol. Its IUPAC name is 5-[2-[2-[2-(3-carboxy-4-hydroxyphenyl)ethenyl]phenyl]ethenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[2-[2-(3-carboxy-4-hydroxyphenyl)ethenyl]phenyl]ethenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 54231084 |
| Molecular Formula | C24H18O6 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 5-[2-[2-[2-(3-carboxy-4-hydroxyphenyl)ethenyl]phenyl]ethenyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(C=Cc2ccccc2C=Cc2ccc(O)c(C(=O)O)c2)ccc1O |
| InChI | InChI=1S/C24H18O6/c25-21-11-7-15(13-19(21)23(27)28)5-9-17-3-1-2-4-18(17)10-6-16-8-12-22(26)20(14-16)24(29)30/h1-14,25-26H,(H,27,28)(H,29,30) |
| InChIKey | QJHRIACNMRHIOO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|