C20H22N2O — CID 52936918
(1E,4E)-1-[4-(dimethylamino)phenyl]-5-[3-(methylamino)phenyl]penta-1,4-dien-3-one (PubChem CID 52936918) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (1E,4E)-1-[4-(dimethylamino)phenyl]-5-[3-(methylamino)phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-[3-(methylamino)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 52936918 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-[3-(methylamino)phenyl]penta-1,4-dien-3-one |
| SMILES | CNc1cccc(/C=C/C(=O)/C=C/c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C20H22N2O/c1-21-18-6-4-5-17(15-18)10-14-20(23)13-9-16-7-11-19(12-8-16)22(2)3/h4-15,21H,1-3H3/b13-9+,14-10+ |
| InChIKey | XJTHBUVLESPZBT-UTLPMFLDSA-N |
| XLogP | 4.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|