C18H18ClN3O2 — CID 26184751
N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide (PubChem CID 26184751) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide.
| Compound Name | N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide |
|---|---|
| PubChem CID | 26184751 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)/C=C/c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H18ClN3O2/c1-22(2)16-5-3-4-14(12-16)18(24)21-20-17(23)11-8-13-6-9-15(19)10-7-13/h3-12H,1-2H3,(H,20,23)(H,21,24)/b11-8+ |
| InChIKey | QSRDVRBXVXHCQY-DHZHZOJOSA-N |
| XLogP | 2.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|