C23H23Cl2N5O2S — CID 137273863
(2E)-N-(3,4-dichlorophenyl)-2-[(E)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 137273863) has the molecular formula C23H23Cl2N5O2S and a molecular weight of 504.44 g/mol. Its IUPAC name is (2E)-N-(3,4-dichlorophenyl)-2-[(E)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (2E)-N-(3,4-dichlorophenyl)-2-[(E)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 137273863 |
| Molecular Formula | C23H23Cl2N5O2S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | (2E)-N-(3,4-dichlorophenyl)-2-[(E)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CC(/C=C/c1ccc(N(C)C)cc1)=N\N=C1/NC(=O)CC(C(=O)Nc2ccc(Cl)c(Cl)c2)S1 |
| InChI | InChI=1S/C23H23Cl2N5O2S/c1-14(4-5-15-6-9-17(10-7-15)30(2)3)28-29-23-27-21(31)13-20(33-23)22(32)26-16-8-11-18(24)19(25)12-16/h4-12,20H,13H2,1-3H3,(H,26,32)(H,27,29,31)/b5-4+,28-14+ |
| InChIKey | YYDOHIHBTUFZRP-HBWCYYAZSA-N |
| XLogP | 5.06 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|