C23H24FN5O2S — CID 135470558
2-[4-[4-(dimethylamino)phenyl]but-3-en-2-ylidenehydrazinylidene]-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 135470558) has the molecular formula C23H24FN5O2S and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-[4-[4-(dimethylamino)phenyl]but-3-en-2-ylidenehydrazinylidene]-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[4-[4-(dimethylamino)phenyl]but-3-en-2-ylidenehydrazinylidene]-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135470558 |
| Molecular Formula | C23H24FN5O2S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-[4-[4-(dimethylamino)phenyl]but-3-en-2-ylidenehydrazinylidene]-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CC(C=Cc1ccc(N(C)C)cc1)=NN=C1NC(=O)CC(C(=O)Nc2ccccc2F)S1 |
| InChI | InChI=1S/C23H24FN5O2S/c1-15(8-9-16-10-12-17(13-11-16)29(2)3)27-28-23-26-21(30)14-20(32-23)22(31)25-19-7-5-4-6-18(19)24/h4-13,20H,14H2,1-3H3,(H,25,31)(H,26,28,30) |
| InChIKey | XFVCNFYCVXWKNB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|