C22H21FN4O4S — CID 172967162
2-[(E)-4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 172967162) has the molecular formula C22H21FN4O4S and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[(E)-4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[(E)-4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 172967162 |
| Molecular Formula | C22H21FN4O4S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[(E)-4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | C/C(CCc1ccc2c(c1)OCO2)=N\N=C1NC(=O)CC(C(=O)Nc2ccccc2F)S1 |
| InChI | InChI=1S/C22H21FN4O4S/c1-13(6-7-14-8-9-17-18(10-14)31-12-30-17)26-27-22-25-20(28)11-19(32-22)21(29)24-16-5-3-2-4-15(16)23/h2-5,8-10,19H,6-7,11-12H2,1H3,(H,24,29)(H,25,27,28)/b26-13+ |
| InChIKey | UPRAQWFUJMSLDD-LGJNPRDNSA-N |
| XLogP | 3.48 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|