C23H22N4O6S — CID 135460449
4-[[(2Z)-2-[(E)-4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 135460449) has the molecular formula C23H22N4O6S and a molecular weight of 482.52 g/mol. Its IUPAC name is 4-[[(2Z)-2-[(E)-4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(2Z)-2-[(E)-4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135460449 |
| Molecular Formula | C23H22N4O6S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 4-[[(2Z)-2-[(E)-4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | C/C(CCc1ccc2c(c1)OCO2)=N\N=C1\NC(=O)CC(C(=O)Nc2ccc(C(=O)O)cc2)S1 |
| InChI | InChI=1S/C23H22N4O6S/c1-13(2-3-14-4-9-17-18(10-14)33-12-32-17)26-27-23-25-20(28)11-19(34-23)21(29)24-16-7-5-15(6-8-16)22(30)31/h4-10,19H,2-3,11-12H2,1H3,(H,24,29)(H,30,31)(H,25,27,28)/b26-13+ |
| InChIKey | GHFDDNKKWIRHCB-LGJNPRDNSA-N |
| XLogP | 3.04 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|