C21H19FN4O5S — CID 135922474
4-[[(2Z,6S)-2-[(Z)-1-(3-fluoro-4-methoxyphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 135922474) has the molecular formula C21H19FN4O5S and a molecular weight of 458.47 g/mol. Its IUPAC name is 4-[[(2Z,6S)-2-[(Z)-1-(3-fluoro-4-methoxyphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(2Z,6S)-2-[(Z)-1-(3-fluoro-4-methoxyphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135922474 |
| Molecular Formula | C21H19FN4O5S |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 4-[[(2Z,6S)-2-[(Z)-1-(3-fluoro-4-methoxyphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | COc1ccc(/C(C)=N\N=C2\NC(=O)C[C@@H](C(=O)Nc3ccc(C(=O)O)cc3)S2)cc1F |
| InChI | InChI=1S/C21H19FN4O5S/c1-11(13-5-8-16(31-2)15(22)9-13)25-26-21-24-18(27)10-17(32-21)19(28)23-14-6-3-12(4-7-14)20(29)30/h3-9,17H,10H2,1-2H3,(H,23,28)(H,29,30)(H,24,26,27)/b25-11-/t17-/m0/s1 |
| InChIKey | QCBSDOOJAABFEA-ZQTIHHSBSA-N |
| XLogP | 2.87 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|