C24H24N4O6S — CID 135534052
methyl 4-[[2-[4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 135534052) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is methyl 4-[[2-[4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 135534052 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | methyl 4-[[2-[4-(1,3-benzodioxol-5-yl)butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CC(=O)NC(=NN=C(C)CCc3ccc4c(c3)OCO4)S2)cc1 |
| InChI | InChI=1S/C24H24N4O6S/c1-14(3-4-15-5-10-18-19(11-15)34-13-33-18)27-28-24-26-21(29)12-20(35-24)22(30)25-17-8-6-16(7-9-17)23(31)32-2/h5-11,20H,3-4,12-13H2,1-2H3,(H,25,30)(H,26,28,29) |
| InChIKey | XKPOGLFISCHYDE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|