C20H20N4O4S2 — CID 135714961
ethyl 4-[[(2E)-4-oxo-2-(1-thiophen-2-ylethylidenehydrazinylidene)-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 135714961) has the molecular formula C20H20N4O4S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is ethyl 4-[[(2E)-4-oxo-2-(1-thiophen-2-ylethylidenehydrazinylidene)-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[(2E)-4-oxo-2-(1-thiophen-2-ylethylidenehydrazinylidene)-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 135714961 |
| Molecular Formula | C20H20N4O4S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | ethyl 4-[[(2E)-4-oxo-2-(1-thiophen-2-ylethylidenehydrazinylidene)-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CC(=O)N/C(=N\N=C(C)c3cccs3)S2)cc1 |
| InChI | InChI=1S/C20H20N4O4S2/c1-3-28-19(27)13-6-8-14(9-7-13)21-18(26)16-11-17(25)22-20(30-16)24-23-12(2)15-5-4-10-29-15/h4-10,16H,3,11H2,1-2H3,(H,21,26)(H,22,24,25) |
| InChIKey | VGQORMLVZOSFTB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|