C17H15ClN4O2S2 — CID 135906167
(2Z,6R)-N-(3-chlorophenyl)-4-oxo-2-[(Z)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide (PubChem CID 135906167) has the molecular formula C17H15ClN4O2S2 and a molecular weight of 406.92 g/mol. Its IUPAC name is (2Z,6R)-N-(3-chlorophenyl)-4-oxo-2-[(Z)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide.
| Compound Name | (2Z,6R)-N-(3-chlorophenyl)-4-oxo-2-[(Z)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135906167 |
| Molecular Formula | C17H15ClN4O2S2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | (2Z,6R)-N-(3-chlorophenyl)-4-oxo-2-[(Z)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
| SMILES | C/C(=N/N=C1/NC(=O)C[C@H](C(=O)Nc2cccc(Cl)c2)S1)c1cccs1 |
| InChI | InChI=1S/C17H15ClN4O2S2/c1-10(13-6-3-7-25-13)21-22-17-20-15(23)9-14(26-17)16(24)19-12-5-2-4-11(18)8-12/h2-8,14H,9H2,1H3,(H,19,24)(H,20,22,23)/b21-10-/t14-/m1/s1 |
| InChIKey | UOJRZGJIUWEXEB-YYLUKMIBSA-N |
| XLogP | 3.74 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|