C17H14Cl2N4O2S2 — CID 135549803
(2E)-N-(3,4-dichlorophenyl)-4-oxo-2-[(E)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide (PubChem CID 135549803) has the molecular formula C17H14Cl2N4O2S2 and a molecular weight of 441.37 g/mol. Its IUPAC name is (2E)-N-(3,4-dichlorophenyl)-4-oxo-2-[(E)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide.
| Compound Name | (2E)-N-(3,4-dichlorophenyl)-4-oxo-2-[(E)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135549803 |
| Molecular Formula | C17H14Cl2N4O2S2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | (2E)-N-(3,4-dichlorophenyl)-4-oxo-2-[(E)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
| SMILES | C/C(=N\N=C1/NC(=O)CC(C(=O)Nc2ccc(Cl)c(Cl)c2)S1)c1cccs1 |
| InChI | InChI=1S/C17H14Cl2N4O2S2/c1-9(13-3-2-6-26-13)22-23-17-21-15(24)8-14(27-17)16(25)20-10-4-5-11(18)12(19)7-10/h2-7,14H,8H2,1H3,(H,20,25)(H,21,23,24)/b22-9+ |
| InChIKey | RNUJKTAUFGGGHG-LSFURLLWSA-N |
| XLogP | 4.40 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|