C18H18N4O3S2 — CID 135489609
N-(4-methoxyphenyl)-4-oxo-2-(1-thiophen-2-ylethylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide (PubChem CID 135489609) has the molecular formula C18H18N4O3S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-oxo-2-(1-thiophen-2-ylethylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-4-oxo-2-(1-thiophen-2-ylethylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135489609 |
| Molecular Formula | C18H18N4O3S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-(4-methoxyphenyl)-4-oxo-2-(1-thiophen-2-ylethylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(=O)NC(=NN=C(C)c3cccs3)S2)cc1 |
| InChI | InChI=1S/C18H18N4O3S2/c1-11(14-4-3-9-26-14)21-22-18-20-16(23)10-15(27-18)17(24)19-12-5-7-13(25-2)8-6-12/h3-9,15H,10H2,1-2H3,(H,19,24)(H,20,22,23) |
| InChIKey | BUQCDRUHKDAFIX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|