C11H12N4O2S2 — CID 137226815
4-oxo-2-[(E)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide (PubChem CID 137226815) has the molecular formula C11H12N4O2S2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 4-oxo-2-[(E)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide.
| Compound Name | 4-oxo-2-[(E)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 137226815 |
| Molecular Formula | C11H12N4O2S2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-oxo-2-[(E)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
| SMILES | C/C(=N\N=C1NC(=O)CC(C(N)=O)S1)c1cccs1 |
| InChI | InChI=1S/C11H12N4O2S2/c1-6(7-3-2-4-18-7)14-15-11-13-9(16)5-8(19-11)10(12)17/h2-4,8H,5H2,1H3,(H2,12,17)(H,13,15,16)/b14-6+ |
| InChIKey | HGKQVIXQQPSAMY-MKMNVTDBSA-N |
| XLogP | 0.94 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|