C19H15ClN4O4S — CID 135706066
(2E)-2-(1,3-benzodioxol-5-ylmethylidenehydrazinylidene)-N-(3-chlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 135706066) has the molecular formula C19H15ClN4O4S and a molecular weight of 430.87 g/mol. Its IUPAC name is (2E)-2-(1,3-benzodioxol-5-ylmethylidenehydrazinylidene)-N-(3-chlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (2E)-2-(1,3-benzodioxol-5-ylmethylidenehydrazinylidene)-N-(3-chlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135706066 |
| Molecular Formula | C19H15ClN4O4S |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (2E)-2-(1,3-benzodioxol-5-ylmethylidenehydrazinylidene)-N-(3-chlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2cccc(Cl)c2)S/C(=N/N=Cc2ccc3c(c2)OCO3)N1 |
| InChI | InChI=1S/C19H15ClN4O4S/c20-12-2-1-3-13(7-12)22-18(26)16-8-17(25)23-19(29-16)24-21-9-11-4-5-14-15(6-11)28-10-27-14/h1-7,9,16H,8,10H2,(H,22,26)(H,23,24,25) |
| InChIKey | DBNJDXHMZNFGMM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|