C23H24BrN5O2S — CID 136897387
(2Z,6R)-N-(4-bromophenyl)-2-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 136897387) has the molecular formula C23H24BrN5O2S and a molecular weight of 514.45 g/mol. Its IUPAC name is (2Z,6R)-N-(4-bromophenyl)-2-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (2Z,6R)-N-(4-bromophenyl)-2-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 136897387 |
| Molecular Formula | C23H24BrN5O2S |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (2Z,6R)-N-(4-bromophenyl)-2-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CC(/C=C/c1ccc(N(C)C)cc1)=N/N=C1/NC(=O)C[C@H](C(=O)Nc2ccc(Br)cc2)S1 |
| InChI | InChI=1S/C23H24BrN5O2S/c1-15(4-5-16-6-12-19(13-7-16)29(2)3)27-28-23-26-21(30)14-20(32-23)22(31)25-18-10-8-17(24)9-11-18/h4-13,20H,14H2,1-3H3,(H,25,31)(H,26,28,30)/b5-4+,27-15-/t20-/m1/s1 |
| InChIKey | MRQNHPSPQNWFSF-TZGGXPEESA-N |
| XLogP | 4.52 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|