C23H22ClN5O — CID 85471704
N-[4-chloro-3-(6-methyl-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-2-[4-(dimethylamino)phenyl]acetamide (PubChem CID 85471704) has the molecular formula C23H22ClN5O and a molecular weight of 419.92 g/mol. Its IUPAC name is N-[4-chloro-3-(6-methyl-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-2-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | N-[4-chloro-3-(6-methyl-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-2-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 85471704 |
| Molecular Formula | C23H22ClN5O |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[4-chloro-3-(6-methyl-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-2-[4-(dimethylamino)phenyl]acetamide |
| SMILES | Cc1cnc2nc(-c3cc(NC(=O)Cc4ccc(N(C)C)cc4)ccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C23H22ClN5O/c1-14-10-20-23(25-13-14)28-22(27-20)18-12-16(6-9-19(18)24)26-21(30)11-15-4-7-17(8-5-15)29(2)3/h4-10,12-13H,11H2,1-3H3,(H,26,30)(H,25,27,28) |
| InChIKey | ARJXAFBTXXOKRQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|