C29H22Cl2N2O5S — CID 161416397
methyl (E)-3-[3-[[3-chloro-4-[(4-chloro-3-pyridin-2-ylphenyl)carbamoyl]phenyl]sulfonylmethyl]phenyl]prop-2-enoate (PubChem CID 161416397) has the molecular formula C29H22Cl2N2O5S and a molecular weight of 581.48 g/mol. Its IUPAC name is methyl (E)-3-[3-[[3-chloro-4-[(4-chloro-3-pyridin-2-ylphenyl)carbamoyl]phenyl]sulfonylmethyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[3-chloro-4-[(4-chloro-3-pyridin-2-ylphenyl)carbamoyl]phenyl]sulfonylmethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 161416397 |
| Molecular Formula | C29H22Cl2N2O5S |
| Molecular Weight | 581.48 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | methyl (E)-3-[3-[[3-chloro-4-[(4-chloro-3-pyridin-2-ylphenyl)carbamoyl]phenyl]sulfonylmethyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(CS(=O)(=O)c2ccc(C(=O)Nc3ccc(Cl)c(-c4ccccn4)c3)c(Cl)c2)c1 |
| InChI | InChI=1S/C29H22Cl2N2O5S/c1-38-28(34)13-8-19-5-4-6-20(15-19)18-39(36,37)22-10-11-23(26(31)17-22)29(35)33-21-9-12-25(30)24(16-21)27-7-2-3-14-32-27/h2-17H,18H2,1H3,(H,33,35)/b13-8+ |
| InChIKey | MDWOLHHXECVPRZ-MDWZMJQESA-N |
| XLogP | 6.47 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.48 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|