C25H17Cl2N3O4S — CID 172682524
2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-3-[(3-formylphenyl)sulfamoyl]benzamide (PubChem CID 172682524) has the molecular formula C25H17Cl2N3O4S and a molecular weight of 526.40 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-3-[(3-formylphenyl)sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-3-[(3-formylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 172682524 |
| Molecular Formula | C25H17Cl2N3O4S |
| Molecular Weight | 526.40 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | 2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-3-[(3-formylphenyl)sulfamoyl]benzamide |
| SMILES | O=Cc1cccc(NS(=O)(=O)c2cccc(C(=O)Nc3ccc(Cl)c(-c4ccccn4)c3)c2Cl)c1 |
| InChI | InChI=1S/C25H17Cl2N3O4S/c26-21-11-10-17(14-20(21)22-8-1-2-12-28-22)29-25(32)19-7-4-9-23(24(19)27)35(33,34)30-18-6-3-5-16(13-18)15-31/h1-15,30H,(H,29,32) |
| InChIKey | APEQPECARAYVAG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.40 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|