C12H9N3OS — CID 90603545
N-(5-cyano-1,3-thiazol-2-yl)-3-methylbenzamide (PubChem CID 90603545) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is N-(5-cyano-1,3-thiazol-2-yl)-3-methylbenzamide.
| Compound Name | N-(5-cyano-1,3-thiazol-2-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 90603545 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-(5-cyano-1,3-thiazol-2-yl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ncc(C#N)s2)c1 |
| InChI | InChI=1S/C12H9N3OS/c1-8-3-2-4-9(5-8)11(16)15-12-14-7-10(6-13)17-12/h2-5,7H,1H3,(H,14,15,16) |
| InChIKey | DCROIGIOEISAPM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |