C16H20N3O2S+ — CID 7161875
3-methyl-N-[5-(morpholin-4-ium-4-ylmethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 7161875) has the molecular formula C16H20N3O2S+ and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-methyl-N-[5-(morpholin-4-ium-4-ylmethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-methyl-N-[5-(morpholin-4-ium-4-ylmethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 7161875 |
| Molecular Formula | C16H20N3O2S+ |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 3-methyl-N-[5-(morpholin-4-ium-4-ylmethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ncc(C[NH+]3CCOCC3)s2)c1 |
| InChI | InChI=1S/C16H19N3O2S/c1-12-3-2-4-13(9-12)15(20)18-16-17-10-14(22-16)11-19-5-7-21-8-6-19/h2-4,9-10H,5-8,11H2,1H3,(H,17,18,20)/p+1 |
| InChIKey | AVBAFXWFTJKTHL-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |