C10H8N2O4S2 — CID 89199451
2-[(3-hydroxybenzoyl)amino]-1,3-thiazole-5-sulfinic acid (PubChem CID 89199451) has the molecular formula C10H8N2O4S2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[(3-hydroxybenzoyl)amino]-1,3-thiazole-5-sulfinic acid.
| Compound Name | 2-[(3-hydroxybenzoyl)amino]-1,3-thiazole-5-sulfinic acid |
|---|---|
| PubChem CID | 89199451 |
| Molecular Formula | C10H8N2O4S2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 2-[(3-hydroxybenzoyl)amino]-1,3-thiazole-5-sulfinic acid |
| SMILES | O=C(Nc1ncc(S(=O)O)s1)c1cccc(O)c1 |
| InChI | InChI=1S/C10H8N2O4S2/c13-7-3-1-2-6(4-7)9(14)12-10-11-5-8(17-10)18(15)16/h1-5,13H,(H,15,16)(H,11,12,14) |
| InChIKey | OZUPVBZFACFKFF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|