C11H10N2O4S2 — CID 174602871
[2-[(3-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]methanesulfinic acid (PubChem CID 174602871) has the molecular formula C11H10N2O4S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is [2-[(3-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]methanesulfinic acid.
| Compound Name | [2-[(3-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174602871 |
| Molecular Formula | C11H10N2O4S2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | [2-[(3-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]methanesulfinic acid |
| SMILES | O=C(Nc1nc(CS(=O)O)cs1)c1cccc(O)c1 |
| InChI | InChI=1S/C11H10N2O4S2/c14-9-3-1-2-7(4-9)10(15)13-11-12-8(5-18-11)6-19(16)17/h1-5,14H,6H2,(H,16,17)(H,12,13,15) |
| InChIKey | VVLWFCDJCDITOK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|