C11H9N2O4S2- — CID 174617807
[2-[(2-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]methanesulfinate (PubChem CID 174617807) has the molecular formula C11H9N2O4S2- and a molecular weight of 297.34 g/mol. Its IUPAC name is [2-[(2-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]methanesulfinate.
| Compound Name | [2-[(2-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]methanesulfinate |
|---|---|
| PubChem CID | 174617807 |
| Molecular Formula | C11H9N2O4S2- |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | [2-[(2-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]methanesulfinate |
| SMILES | O=C(Nc1nc(CS(=O)[O-])cs1)c1ccccc1O |
| InChI | InChI=1S/C11H10N2O4S2/c14-9-4-2-1-3-8(9)10(15)13-11-12-7(5-18-11)6-19(16)17/h1-5,14H,6H2,(H,16,17)(H,12,13,15)/p-1 |
| InChIKey | CVRYXBTVNLUBIA-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|