C16H12N2O4S2 — CID 50905290
N-[4-(benzenesulfonyl)-1,3-thiazol-2-yl]-2-hydroxybenzamide (PubChem CID 50905290) has the molecular formula C16H12N2O4S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[4-(benzenesulfonyl)-1,3-thiazol-2-yl]-2-hydroxybenzamide.
| Compound Name | N-[4-(benzenesulfonyl)-1,3-thiazol-2-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 50905290 |
| Molecular Formula | C16H12N2O4S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-[4-(benzenesulfonyl)-1,3-thiazol-2-yl]-2-hydroxybenzamide |
| SMILES | O=C(Nc1nc(S(=O)(=O)c2ccccc2)cs1)c1ccccc1O |
| InChI | InChI=1S/C16H12N2O4S2/c19-13-9-5-4-8-12(13)15(20)18-16-17-14(10-23-16)24(21,22)11-6-2-1-3-7-11/h1-10,19H,(H,17,18,20) |
| InChIKey | PBXGOCAHDMHAHJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |