C17H20N2O5S2 — CID 57329900
[2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate (PubChem CID 57329900) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate.
| Compound Name | [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate |
|---|---|
| PubChem CID | 57329900 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccccc1C(=O)Nc1nc(S(C)(=O)=O)cs1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-3-4-5-10-15(20)24-13-9-7-6-8-12(13)16(21)19-17-18-14(11-25-17)26(2,22)23/h6-9,11H,3-5,10H2,1-2H3,(H,18,19,21) |
| InChIKey | OVTABJUKWLHZGR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|