About [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate
[2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate (PubChem CID 57329900) has the molecular formula C17H20N2O5S2
and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate.
Molecular Properties
| Compound Name | [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate |
| PubChem CID | 57329900 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccccc1C(=O)Nc1nc(S(C)(=O)=O)cs1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-3-4-5-10-15(20)24-13-9-7-6-8-12(13)16(21)19-17-18-14(11-25-17)26(2,22)23/h6-9,11H,3-5,10H2,1-2H3,(H,18,19,21) |
| InChIKey | OVTABJUKWLHZGR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate?
The IUPAC name of [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate (CID 57329900) is [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate.
What is the SMILES notation for [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate?
The canonical SMILES for [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate is CCCCCC(=O)Oc1ccccc1C(=O)Nc1nc(S(C)(=O)=O)cs1.
What is the InChIKey of [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate?
The InChIKey is OVTABJUKWLHZGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O5S2/c1-3-4-5-10-15(20)24-13-9-7-6-8-12(13)16(21)19-17-18-14(11-25-17)26(2,22)23/h6-9,11H,3-5,10H2,1-2H3,(H,18,19,21).
What are the key properties of [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate?
[2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate has a molecular weight of 396.49 g/mol, XLogP of 3.28, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] hexanoate is sourced from PubChem (CID 57329900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).