C15H17N3O3S — CID 16915665
2-[(2-ethoxybenzoyl)amino]-N-ethyl-1,3-thiazole-4-carboxamide (PubChem CID 16915665) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-[(2-ethoxybenzoyl)amino]-N-ethyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2-ethoxybenzoyl)amino]-N-ethyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16915665 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[(2-ethoxybenzoyl)amino]-N-ethyl-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=O)c1csc(NC(=O)c2ccccc2OCC)n1 |
| InChI | InChI=1S/C15H17N3O3S/c1-3-16-14(20)11-9-22-15(17-11)18-13(19)10-7-5-6-8-12(10)21-4-2/h5-9H,3-4H2,1-2H3,(H,16,20)(H,17,18,19) |
| InChIKey | HRVQXFJICXYHQR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |