C19H23N3O3S — CID 32867568
N-[4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-2-ethoxybenzamide (PubChem CID 32867568) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-2-ethoxybenzamide.
| Compound Name | N-[4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 32867568 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)Nc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C19H23N3O3S/c1-2-25-16-7-4-3-6-14(16)18(24)20-11-5-8-17(23)22-19-21-15(12-26-19)13-9-10-13/h3-4,6-7,12-13H,2,5,8-11H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | OUECXXITFFWLAG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|