C19H26N4O3S — CID 51237499
2-ethoxy-N-[4-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-4-oxobutyl]benzamide (PubChem CID 51237499) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-ethoxy-N-[4-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-4-oxobutyl]benzamide.
| Compound Name | 2-ethoxy-N-[4-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 51237499 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-ethoxy-N-[4-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]-4-oxobutyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)Nc1nnc(CC(C)C)s1 |
| InChI | InChI=1S/C19H26N4O3S/c1-4-26-15-9-6-5-8-14(15)18(25)20-11-7-10-16(24)21-19-23-22-17(27-19)12-13(2)3/h5-6,8-9,13H,4,7,10-12H2,1-3H3,(H,20,25)(H,21,23,24) |
| InChIKey | VFFMUUNJSDMGNW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|